C24H26ClFN4 — CID 124781848
N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(cyclohexen-1-yl)ethanamine (PubChem CID 124781848) has the molecular formula C24H26ClFN4 and a molecular weight of 424.95 g/mol. Its IUPAC name is N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(cyclohexen-1-yl)ethanamine.
| Compound Name | N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(cyclohexen-1-yl)ethanamine |
|---|---|
| PubChem CID | 124781848 |
| Molecular Formula | C24H26ClFN4 |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(cyclohexen-1-yl)ethanamine |
| SMILES | Fc1cccc(Cl)c1Cn1nc(CNCCC2=CCCCC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H26ClFN4/c25-21-12-7-13-22(26)20(21)17-30-28-23(24(29-30)19-10-5-2-6-11-19)16-27-15-14-18-8-3-1-4-9-18/h2,5-8,10-13,27H,1,3-4,9,14-17H2 |
| InChIKey | BPWSTWATAXFWKT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|