C24H20Cl4N4 — CID 124895412
2-(2,4-dichlorophenyl)-N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine (PubChem CID 124895412) has the molecular formula C24H20Cl4N4 and a molecular weight of 506.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 124895412 |
| Molecular Formula | C24H20Cl4N4 |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
| SMILES | Clc1ccc(CCNCc2nn(Cc3ccc(Cl)cc3Cl)nc2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl4N4/c25-19-8-6-16(21(27)12-19)10-11-29-14-23-24(17-4-2-1-3-5-17)31-32(30-23)15-18-7-9-20(26)13-22(18)28/h1-9,12-13,29H,10-11,14-15H2 |
| InChIKey | IPONICITOWLYAL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|