C22H26Cl2N4O — CID 124869146
N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 124869146) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 124869146 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | CC(C)OCCCNCc1nn(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H26Cl2N4O/c1-16(2)29-12-6-11-25-14-21-22(17-7-4-3-5-8-17)27-28(26-21)15-18-9-10-19(23)13-20(18)24/h3-5,7-10,13,16,25H,6,11-12,14-15H2,1-2H3 |
| InChIKey | GIEHLMZCTPHXOW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|