C19H20Cl2N4O — CID 124790090
N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 124790090) has the molecular formula C19H20Cl2N4O and a molecular weight of 391.30 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 124790090 |
| Molecular Formula | C19H20Cl2N4O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nn(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20Cl2N4O/c1-26-10-9-22-12-18-19(14-5-3-2-4-6-14)24-25(23-18)13-15-7-8-16(20)11-17(15)21/h2-8,11,22H,9-10,12-13H2,1H3 |
| InChIKey | HJWVXWYCWTWRGN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|