C24H21ClF2N4 — CID 124783299
N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 124783299) has the molecular formula C24H21ClF2N4 and a molecular weight of 438.91 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 124783299 |
| Molecular Formula | C24H21ClF2N4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | Fc1ccc(Cn2nc(CNCCc3ccccc3F)c(-c3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C24H21ClF2N4/c25-21-14-20(26)11-10-19(21)16-31-29-23(24(30-31)18-7-2-1-3-8-18)15-28-13-12-17-6-4-5-9-22(17)27/h1-11,14,28H,12-13,15-16H2 |
| InChIKey | NLCJDEFBPRTCIJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|