C20H23FN4 — CID 124808324
2-(2-fluorophenyl)-N-[(5-phenyl-2-propyltriazol-4-yl)methyl]ethanamine (PubChem CID 124808324) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(5-phenyl-2-propyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(2-fluorophenyl)-N-[(5-phenyl-2-propyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 124808324 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(5-phenyl-2-propyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCCn1nc(CNCCc2ccccc2F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H23FN4/c1-2-14-25-23-19(20(24-25)17-9-4-3-5-10-17)15-22-13-12-16-8-6-7-11-18(16)21/h3-11,22H,2,12-15H2,1H3 |
| InChIKey | UDNCGLSQUCZCFK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|