C20H23FN4 — CID 124825153
N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 124825153) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 124825153 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1nn(Cc2ccccc2F)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H23FN4/c1-20(2,3)22-13-18-19(15-9-5-4-6-10-15)24-25(23-18)14-16-11-7-8-12-17(16)21/h4-12,22H,13-14H2,1-3H3 |
| InChIKey | UVOSTSHSVAUMSY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |