C21H26N4 — CID 124818737
2-methyl-N-[[2-[(2-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-2-amine (PubChem CID 124818737) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-methyl-N-[[2-[(2-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[2-[(2-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 124818737 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-methyl-N-[[2-[(2-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-2-amine |
| SMILES | Cc1ccccc1Cn1nc(CNC(C)(C)C)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H26N4/c1-16-10-8-9-13-18(16)15-25-23-19(14-22-21(2,3)4)20(24-25)17-11-6-5-7-12-17/h5-13,22H,14-15H2,1-4H3 |
| InChIKey | CMZSVZBVLPOSRT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |