C21H26FN5 — CID 125114903
N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 125114903) has the molecular formula C21H26FN5 and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 125114903 |
| Molecular Formula | C21H26FN5 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1nn(Cc2ccccc2F)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H26FN5/c1-26(2)14-8-13-23-15-20-21(17-9-4-3-5-10-17)25-27(24-20)16-18-11-6-7-12-19(18)22/h3-7,9-12,23H,8,13-16H2,1-2H3 |
| InChIKey | WYMACOUYBVOKGD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|