C27H37ClFN5 — CID 125114495
N',N'-dibutyl-N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine (PubChem CID 125114495) has the molecular formula C27H37ClFN5 and a molecular weight of 486.08 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 125114495 |
| Molecular Formula | C27H37ClFN5 |
| Molecular Weight | 486.08 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N',N'-dibutyl-N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1nn(Cc2ccc(F)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H37ClFN5/c1-3-5-16-33(17-6-4-2)18-10-15-30-20-26-27(22-11-8-7-9-12-22)32-34(31-26)21-23-13-14-24(29)19-25(23)28/h7-9,11-14,19,30H,3-6,10,15-18,20-21H2,1-2H3 |
| InChIKey | MARYKSCVZSUMAE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.08 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|