C21H24ClFN4O — CID 124826738
N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-ethoxypropan-1-amine (PubChem CID 124826738) has the molecular formula C21H24ClFN4O and a molecular weight of 402.90 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 124826738 |
| Molecular Formula | C21H24ClFN4O |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1nn(Cc2ccc(F)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H24ClFN4O/c1-2-28-12-6-11-24-14-20-21(16-7-4-3-5-8-16)26-27(25-20)15-17-9-10-18(23)13-19(17)22/h3-5,7-10,13,24H,2,6,11-12,14-15H2,1H3 |
| InChIKey | UPAHRUZXKQNUFN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|