C21H24ClFN4 — CID 124825930
N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-methylbutan-1-amine (PubChem CID 124825930) has the molecular formula C21H24ClFN4 and a molecular weight of 386.90 g/mol. Its IUPAC name is N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 124825930 |
| Molecular Formula | C21H24ClFN4 |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[[2-[(2-chloro-4-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-methylbutan-1-amine |
| SMILES | CC(C)CCNCc1nn(Cc2ccc(F)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H24ClFN4/c1-15(2)10-11-24-13-20-21(16-6-4-3-5-7-16)26-27(25-20)14-17-8-9-18(23)12-19(17)22/h3-9,12,15,24H,10-11,13-14H2,1-2H3 |
| InChIKey | QNSMLTWCBRCXCY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|