C22H25Cl2N5O — CID 125114723
N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 125114723) has the molecular formula C22H25Cl2N5O and a molecular weight of 446.38 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 125114723 |
| Molecular Formula | C22H25Cl2N5O |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | Clc1ccc(Cn2nc(CNCCN3CCOCC3)c(-c3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N5O/c23-19-7-6-18(20(24)14-19)16-29-26-21(22(27-29)17-4-2-1-3-5-17)15-25-8-9-28-10-12-30-13-11-28/h1-7,14,25H,8-13,15-16H2 |
| InChIKey | UAFSPGPHDMSZOO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|