C24H26Cl2N4 — CID 124895664
2-(cyclohexen-1-yl)-N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine (PubChem CID 124895664) has the molecular formula C24H26Cl2N4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 124895664 |
| Molecular Formula | C24H26Cl2N4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
| SMILES | Clc1ccc(Cn2nc(CNCCC3=CCCCC3)c(-c3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C24H26Cl2N4/c25-21-12-11-19(15-22(21)26)17-30-28-23(24(29-30)20-9-5-2-6-10-20)16-27-14-13-18-7-3-1-4-8-18/h2,5-7,9-12,15,27H,1,3-4,8,13-14,16-17H2 |
| InChIKey | OZYULUSWTZCRFI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|