C21H25ClN4O — CID 124787682
5-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol (PubChem CID 124787682) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 5-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol.
| Compound Name | 5-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 124787682 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol |
| SMILES | OCCCCCNCc1nn(Cc2cccc(Cl)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H25ClN4O/c22-19-11-7-8-17(14-19)16-26-24-20(15-23-12-5-2-6-13-27)21(25-26)18-9-3-1-4-10-18/h1,3-4,7-11,14,23,27H,2,5-6,12-13,15-16H2 |
| InChIKey | SQLNCKCGABUEHR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|