C22H28N4O — CID 124800402
5-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol (PubChem CID 124800402) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol.
| Compound Name | 5-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 124800402 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 5-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methylamino]pentan-1-ol |
| SMILES | Cc1cccc(Cn2nc(CNCCCCCO)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H28N4O/c1-18-9-8-10-19(15-18)17-26-24-21(16-23-13-6-3-7-14-27)22(25-26)20-11-4-2-5-12-20/h2,4-5,8-12,15,23,27H,3,6-7,13-14,16-17H2,1H3 |
| InChIKey | UBWKHKCXOWSMIW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|