C24H24N4 — CID 124800161
N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine (PubChem CID 124800161) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 124800161 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine |
| SMILES | Cc1cccc(Cn2nc(CNCc3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H24N4/c1-19-9-8-12-21(15-19)18-28-26-23(17-25-16-20-10-4-2-5-11-20)24(27-28)22-13-6-3-7-14-22/h2-15,25H,16-18H2,1H3 |
| InChIKey | SFLOYODOLCJOOS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |