C23H23N5 — CID 125114228
N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-pyridin-2-ylmethanamine (PubChem CID 125114228) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-pyridin-2-ylmethanamine.
| Compound Name | N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 125114228 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-pyridin-2-ylmethanamine |
| SMILES | Cc1ccc(Cn2nc(CNCc3ccccn3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H23N5/c1-18-10-12-19(13-11-18)17-28-26-22(16-24-15-21-9-5-6-14-25-21)23(27-28)20-7-3-2-4-8-20/h2-14,24H,15-17H2,1H3 |
| InChIKey | BMGUZYMVIBOKQX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |