C23H28N4 — CID 124816332
N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]cyclohexanamine (PubChem CID 124816332) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]cyclohexanamine.
| Compound Name | N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 124816332 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]cyclohexanamine |
| SMILES | Cc1ccc(Cn2nc(CNC3CCCCC3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H28N4/c1-18-12-14-19(15-13-18)17-27-25-22(16-24-21-10-6-3-7-11-21)23(26-27)20-8-4-2-5-9-20/h2,4-5,8-9,12-15,21,24H,3,6-7,10-11,16-17H2,1H3 |
| InChIKey | RVWKHMJDAOTNML-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |