C23H28N4 — CID 124818663
N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]cycloheptanamine (PubChem CID 124818663) has the molecular formula C23H28N4 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]cycloheptanamine.
| Compound Name | N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]cycloheptanamine |
|---|---|
| PubChem CID | 124818663 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]cycloheptanamine |
| SMILES | c1ccc(Cn2nc(CNC3CCCCCC3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H28N4/c1-2-10-16-21(15-9-1)24-17-22-23(20-13-7-4-8-14-20)26-27(25-22)18-19-11-5-3-6-12-19/h3-8,11-14,21,24H,1-2,9-10,15-18H2 |
| InChIKey | YVWQVKCANIZUBE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |