C19H22N4O — CID 51684317
(2R)-1-[(2-benzyl-5-phenyltriazol-4-yl)methylamino]propan-2-ol (PubChem CID 51684317) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-1-[(2-benzyl-5-phenyltriazol-4-yl)methylamino]propan-2-ol.
| Compound Name | (2R)-1-[(2-benzyl-5-phenyltriazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 51684317 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2R)-1-[(2-benzyl-5-phenyltriazol-4-yl)methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1nn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H22N4O/c1-15(24)12-20-13-18-19(17-10-6-3-7-11-17)22-23(21-18)14-16-8-4-2-5-9-16/h2-11,15,20,24H,12-14H2,1H3/t15-/m1/s1 |
| InChIKey | MVAZMUMRGQJYEE-OAHLLOKOSA-N |
| XLogP | 2.46 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |