C26H28N4 — CID 124821452
(2S)-N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-4-phenylbutan-2-amine (PubChem CID 124821452) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is (2S)-N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-4-phenylbutan-2-amine.
| Compound Name | (2S)-N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 124821452 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2S)-N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-4-phenylbutan-2-amine |
| SMILES | C[C@@H](CCc1ccccc1)NCc1nn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H28N4/c1-21(17-18-22-11-5-2-6-12-22)27-19-25-26(24-15-9-4-10-16-24)29-30(28-25)20-23-13-7-3-8-14-23/h2-16,21,27H,17-20H2,1H3/t21-/m0/s1 |
| InChIKey | FYHFXNKHQLRFPL-NRFANRHFSA-N |
| XLogP | 5.10 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |