C25H26N4 — CID 41047282
(2S)-4-phenyl-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]butan-2-amine (PubChem CID 41047282) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is (2S)-4-phenyl-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]butan-2-amine.
| Compound Name | (2S)-4-phenyl-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 41047282 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (2S)-4-phenyl-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]butan-2-amine |
| SMILES | C[C@@H](CCc1ccccc1)NCc1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C25H26N4/c1-20(12-13-21-8-4-2-5-9-21)27-18-23-19-29(24-10-6-3-7-11-24)28-25(23)22-14-16-26-17-15-22/h2-11,14-17,19-20,27H,12-13,18H2,1H3/t20-/m0/s1 |
| InChIKey | NSXBSIKZQFOSRH-FQEVSTJZSA-N |
| XLogP | 5.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |