C21H20N4S — CID 124815871
N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 124815871) has the molecular formula C21H20N4S and a molecular weight of 360.49 g/mol. Its IUPAC name is N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-1-thiophen-2-ylmethanamine.
| Compound Name | N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 124815871 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(2-benzyl-5-phenyltriazol-4-yl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | c1ccc(Cn2nc(CNCc3cccs3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H20N4S/c1-3-8-17(9-4-1)16-25-23-20(15-22-14-19-12-7-13-26-19)21(24-25)18-10-5-2-6-11-18/h1-13,22H,14-16H2 |
| InChIKey | MZDMIZFGCFIIDT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |