C29H36N4 — CID 124817456
(1R)-1-(1-adamantyl)-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine (PubChem CID 124817456) has the molecular formula C29H36N4 and a molecular weight of 440.64 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 124817456 |
| Molecular Formula | C29H36N4 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
| SMILES | Cc1ccc(Cn2nc(CN[C@H](C)C34CC5CC(CC(C5)C3)C4)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H36N4/c1-20-8-10-22(11-9-20)19-33-31-27(28(32-33)26-6-4-3-5-7-26)18-30-21(2)29-15-23-12-24(16-29)14-25(13-23)17-29/h3-11,21,23-25,30H,12-19H2,1-2H3/t21-,23?,24?,25?,29?/m1/s1 |
| InChIKey | WLGPBFPSKQLNCP-WMXVPYMRSA-N |
| XLogP | 6.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |