C15H19F2N — CID 30056275
2-(cyclohexen-1-yl)-N-[(2,6-difluorophenyl)methyl]ethanamine (PubChem CID 30056275) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(2,6-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(2,6-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 30056275 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(2,6-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1cccc(F)c1CNCCC1=CCCCC1 |
| InChI | InChI=1S/C15H19F2N/c16-14-7-4-8-15(17)13(14)11-18-10-9-12-5-2-1-3-6-12/h4-5,7-8,18H,1-3,6,9-11H2 |
| InChIKey | ZOPBIUDBXPZRII-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|