C15H18F2N2S — CID 100601941
1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-difluorophenyl)thiourea (PubChem CID 100601941) has the molecular formula C15H18F2N2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-difluorophenyl)thiourea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 100601941 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,6-difluorophenyl)thiourea |
| SMILES | Fc1cccc(F)c1NC(=S)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H18F2N2S/c16-12-7-4-8-13(17)14(12)19-15(20)18-10-9-11-5-2-1-3-6-11/h4-5,7-8H,1-3,6,9-10H2,(H2,18,19,20) |
| InChIKey | ASAURRLLPNIKRZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|