C19H20F2N4O — CID 109275648
5-[2-(cyclohexen-1-yl)ethylamino]-N-(2,6-difluorophenyl)pyrazine-2-carboxamide (PubChem CID 109275648) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2,6-difluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2,6-difluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109275648 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylamino]-N-(2,6-difluorophenyl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cnc(NCCC2=CCCCC2)cn1 |
| InChI | InChI=1S/C19H20F2N4O/c20-14-7-4-8-15(21)18(14)25-19(26)16-11-24-17(12-23-16)22-10-9-13-5-2-1-3-6-13/h4-5,7-8,11-12H,1-3,6,9-10H2,(H,22,24)(H,25,26) |
| InChIKey | LVESPDNPXOUASS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|