C16H23ClN- — CID 19627969
2-(cyclohexen-1-yl)-N-[(3-methylphenyl)methyl]ethanamine chloride (PubChem CID 19627969) has the molecular formula C16H23ClN- and a molecular weight of 264.82 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(3-methylphenyl)methyl]ethanamine chloride.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(3-methylphenyl)methyl]ethanamine chloride |
|---|---|
| PubChem CID | 19627969 |
| Molecular Formula | C16H23ClN- |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(3-methylphenyl)methyl]ethanamine chloride |
| SMILES | Cc1cccc(CNCCC2=CCCCC2)c1.[Cl-] |
| InChI | InChI=1S/C16H23N.ClH/c1-14-6-5-9-16(12-14)13-17-11-10-15-7-3-2-4-8-15;/h5-7,9,12,17H,2-4,8,10-11,13H2,1H3;1H/p-1 |
| InChIKey | JFYXCAAGUDVWLI-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|