C19H24ClN3O — CID 17210382
2-(cyclohexen-1-yl)-N-[(3-pyrimidin-2-yloxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17210382) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(3-pyrimidin-2-yloxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(3-pyrimidin-2-yloxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17210382 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(3-pyrimidin-2-yloxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | C1=C(CCNCc2cccc(Oc3ncccn3)c2)CCCC1.Cl |
| InChI | InChI=1S/C19H23N3O.ClH/c1-2-6-16(7-3-1)10-13-20-15-17-8-4-9-18(14-17)23-19-21-11-5-12-22-19;/h4-6,8-9,11-12,14,20H,1-3,7,10,13,15H2;1H |
| InChIKey | DSIZXDDNRVWHBQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|