C18H21N — CID 106169984
2-(cyclopenten-1-yl)-N-(naphthalen-2-ylmethyl)ethanamine (PubChem CID 106169984) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-N-(naphthalen-2-ylmethyl)ethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-N-(naphthalen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106169984 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-(cyclopenten-1-yl)-N-(naphthalen-2-ylmethyl)ethanamine |
| SMILES | C1=C(CCNCc2ccc3ccccc3c2)CCC1 |
| InChI | InChI=1S/C18H21N/c1-2-6-15(5-1)11-12-19-14-16-9-10-17-7-3-4-8-18(17)13-16/h3-5,7-10,13,19H,1-2,6,11-12,14H2 |
| InChIKey | AHEYMDLAXXAOMR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|