About 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol
3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol (PubChem CID 17216851) has the molecular formula C27H30Cl2N2O
and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol.
Molecular Properties
| Compound Name | 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol |
| PubChem CID | 17216851 |
| Molecular Formula | C27H30Cl2N2O |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol |
| SMILES | Cc1c(CNC23CC4CC(CC(O)(C4)C2)C3)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H30Cl2N2O/c1-17-23(14-30-26-10-18-8-19(11-26)13-27(32,12-18)16-26)22-4-2-3-5-25(22)31(17)15-20-6-7-21(28)9-24(20)29/h2-7,9,18-19,30,32H,8,10-16H2,1H3 |
| InChIKey | HMWSAEOGWTZSRW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol?
The IUPAC name of 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol (CID 17216851) is 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol.
What is the SMILES notation for 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol?
The canonical SMILES for 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol is Cc1c(CNC23CC4CC(CC(O)(C4)C2)C3)c2ccccc2n1Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol?
The InChIKey is HMWSAEOGWTZSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30Cl2N2O/c1-17-23(14-30-26-10-18-8-19(11-26)13-27(32,12-18)16-26)22-4-2-3-5-25(22)31(17)15-20-6-7-21(28)9-24(20)29/h2-7,9,18-19,30,32H,8,10-16H2,1H3.
What are the key properties of 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol?
3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol has a molecular weight of 469.46 g/mol, XLogP of 6.48, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol is sourced from PubChem (CID 17216851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).