C27H30Cl2N2O — CID 17216851
3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol (PubChem CID 17216851) has the molecular formula C27H30Cl2N2O and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol.
| Compound Name | 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol |
|---|---|
| PubChem CID | 17216851 |
| Molecular Formula | C27H30Cl2N2O |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]adamantan-1-ol |
| SMILES | Cc1c(CNC23CC4CC(CC(O)(C4)C2)C3)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H30Cl2N2O/c1-17-23(14-30-26-10-18-8-19(11-26)13-27(32,12-18)16-26)22-4-2-3-5-25(22)31(17)15-20-6-7-21(28)9-24(20)29/h2-7,9,18-19,30,32H,8,10-16H2,1H3 |
| InChIKey | HMWSAEOGWTZSRW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|