C21H27Cl4N3O — CID 17159682
2-[2-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17159682) has the molecular formula C21H27Cl4N3O and a molecular weight of 479.28 g/mol. Its IUPAC name is 2-[2-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17159682 |
| Molecular Formula | C21H27Cl4N3O |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-[2-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | Cc1c(CNCCNCCO)c2ccccc2n1Cc1ccc(Cl)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C21H25Cl2N3O.2ClH/c1-15-19(13-25-9-8-24-10-11-27)18-4-2-3-5-21(18)26(15)14-16-6-7-17(22)12-20(16)23;;/h2-7,12,24-25,27H,8-11,13-14H2,1H3;2*1H |
| InChIKey | NTGGEEIAWJEFJQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|