C22H28Cl2N2O — CID 17157525
N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17157525) has the molecular formula C22H28Cl2N2O and a molecular weight of 407.39 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17157525 |
| Molecular Formula | C22H28Cl2N2O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1c(C)n(Cc2ccccc2Cl)c2ccccc12.Cl |
| InChI | InChI=1S/C22H27ClN2O.ClH/c1-3-26-14-8-13-24-15-20-17(2)25(22-12-7-5-10-19(20)22)16-18-9-4-6-11-21(18)23;/h4-7,9-12,24H,3,8,13-16H2,1-2H3;1H |
| InChIKey | UETVBZOZNBGXGH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|