C22H30Cl3N3 — CID 17159795
N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17159795) has the molecular formula C22H30Cl3N3 and a molecular weight of 442.86 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17159795 |
| Molecular Formula | C22H30Cl3N3 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | Cc1c(CNCCCN(C)C)c2ccccc2n1Cc1ccccc1Cl.Cl.Cl |
| InChI | InChI=1S/C22H28ClN3.2ClH/c1-17-20(15-24-13-8-14-25(2)3)19-10-5-7-12-22(19)26(17)16-18-9-4-6-11-21(18)23;;/h4-7,9-12,24H,8,13-16H2,1-3H3;2*1H |
| InChIKey | OPPVYOLTKXZIPN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|