C21H25ClN2 — CID 41449135
(2R)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine (PubChem CID 41449135) has the molecular formula C21H25ClN2 and a molecular weight of 340.90 g/mol. Its IUPAC name is (2R)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine.
| Compound Name | (2R)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 41449135 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (2R)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine |
| SMILES | CC[C@@H](C)NCc1c(C)n(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C21H25ClN2/c1-4-15(2)23-13-19-16(3)24(21-12-8-6-10-18(19)21)14-17-9-5-7-11-20(17)22/h5-12,15,23H,4,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | SRKTZPNYFXBENT-OAHLLOKOSA-N |
| XLogP | 5.54 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|