C22H26Cl2N2 — CID 17211023
N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-methylbutan-2-amine (PubChem CID 17211023) has the molecular formula C22H26Cl2N2 and a molecular weight of 389.37 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-methylbutan-2-amine.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 17211023 |
| Molecular Formula | C22H26Cl2N2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCc1c(C)n(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C22H26Cl2N2/c1-5-22(3,4)25-13-19-15(2)26(21-9-7-6-8-18(19)21)14-16-10-11-17(23)12-20(16)24/h6-12,25H,5,13-14H2,1-4H3 |
| InChIKey | CBYCECVUYKDZMQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|