C21H26Cl2N2 — CID 17157793
N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine;hydrochloride (PubChem CID 17157793) has the molecular formula C21H26Cl2N2 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17157793 |
| Molecular Formula | C21H26Cl2N2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1c(C)n(Cc2ccccc2Cl)c2ccccc12.Cl |
| InChI | InChI=1S/C21H25ClN2.ClH/c1-4-15(2)23-13-19-16(3)24(21-12-8-6-10-18(19)21)14-17-9-5-7-11-20(17)22;/h5-12,15,23H,4,13-14H2,1-3H3;1H |
| InChIKey | YCWSSROWYBAQNE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|