C26H24Cl2N6S — CID 17158621
N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 17158621) has the molecular formula C26H24Cl2N6S and a molecular weight of 523.49 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 17158621 |
| Molecular Formula | C26H24Cl2N6S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Cc1c(CNCCSc2nnnn2-c2ccccc2)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N6S/c1-18-23(16-29-13-14-35-26-30-31-32-34(26)21-7-3-2-4-8-21)22-9-5-6-10-25(22)33(18)17-19-11-12-20(27)15-24(19)28/h2-12,15,29H,13-14,16-17H2,1H3 |
| InChIKey | NGAXOYPGLMIJDN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|