C24H25ClN6S — CID 17333317
N-[(9-ethylcarbazol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17333317) has the molecular formula C24H25ClN6S and a molecular weight of 465.03 g/mol. Its IUPAC name is N-[(9-ethylcarbazol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(9-ethylcarbazol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17333317 |
| Molecular Formula | C24H25ClN6S |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[(9-ethylcarbazol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | CCn1c2ccccc2c2cc(CNCCSc3nnnn3-c3ccccc3)ccc21.Cl |
| InChI | InChI=1S/C24H24N6S.ClH/c1-2-29-22-11-7-6-10-20(22)21-16-18(12-13-23(21)29)17-25-14-15-31-24-26-27-28-30(24)19-8-4-3-5-9-19;/h3-13,16,25H,2,14-15,17H2,1H3;1H |
| InChIKey | USNJLGDSZQUABZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|