C19H20N6S — CID 125114504
N-[(1-methylindol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 125114504) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 125114504 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Cn1cc(CNCCSc2nnnn2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H20N6S/c1-24-14-15(17-9-5-6-10-18(17)24)13-20-11-12-26-19-21-22-23-25(19)16-7-3-2-4-8-16/h2-10,14,20H,11-13H2,1H3 |
| InChIKey | MKSPPFRZMUZNKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|