C16H22N6S — CID 125114208
2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1-propan-2-ylindol-3-yl)methyl]ethanamine (PubChem CID 125114208) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1-propan-2-ylindol-3-yl)methyl]ethanamine.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1-propan-2-ylindol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 125114208 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1-propan-2-ylindol-3-yl)methyl]ethanamine |
| SMILES | CC(C)n1cc(CNCCSc2nnnn2C)c2ccccc21 |
| InChI | InChI=1S/C16H22N6S/c1-12(2)22-11-13(14-6-4-5-7-15(14)22)10-17-8-9-23-16-18-19-20-21(16)3/h4-7,11-12,17H,8-10H2,1-3H3 |
| InChIKey | AQFNTAZZNGJPSQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|