C20H32N2 — CID 119027489
N-[(1-propan-2-ylindol-3-yl)methyl]octan-1-amine (PubChem CID 119027489) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-[(1-propan-2-ylindol-3-yl)methyl]octan-1-amine.
| Compound Name | N-[(1-propan-2-ylindol-3-yl)methyl]octan-1-amine |
|---|---|
| PubChem CID | 119027489 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N-[(1-propan-2-ylindol-3-yl)methyl]octan-1-amine |
| SMILES | CCCCCCCCNCc1cn(C(C)C)c2ccccc12 |
| InChI | InChI=1S/C20H32N2/c1-4-5-6-7-8-11-14-21-15-18-16-22(17(2)3)20-13-10-9-12-19(18)20/h9-10,12-13,16-17,21H,4-8,11,14-15H2,1-3H3 |
| InChIKey | SZCFQRQDPGHWFZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|