C21H26ClN5O2S — CID 66532248
N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 66532248) has the molecular formula C21H26ClN5O2S and a molecular weight of 447.99 g/mol. Its IUPAC name is N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 66532248 |
| Molecular Formula | C21H26ClN5O2S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | CCCOc1cc(Cl)c(CNCCSc2nnnn2-c2ccccc2)cc1OCC |
| InChI | InChI=1S/C21H26ClN5O2S/c1-3-11-29-20-14-18(22)16(13-19(20)28-4-2)15-23-10-12-30-21-24-25-26-27(21)17-8-6-5-7-9-17/h5-9,13-14,23H,3-4,10-12,15H2,1-2H3 |
| InChIKey | GCCDBXGUWIVPFV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|