C25H25Cl2N5O2S — CID 66529636
N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66529636) has the molecular formula C25H25Cl2N5O2S and a molecular weight of 530.48 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66529636 |
| Molecular Formula | C25H25Cl2N5O2S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1cc(CNCCCSc2nnnn2-c2ccccc2)c(Cl)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H25Cl2N5O2S/c1-33-23-14-19(22(27)15-24(23)34-17-18-8-5-6-11-21(18)26)16-28-12-7-13-35-25-29-30-31-32(25)20-9-3-2-4-10-20/h2-6,8-11,14-15,28H,7,12-13,16-17H2,1H3 |
| InChIKey | IFKIHZMKERHWIC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|