C24H25Cl2N5OS — CID 17333567
N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17333567) has the molecular formula C24H25Cl2N5OS and a molecular weight of 502.47 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333567 |
| Molecular Formula | C24H25Cl2N5OS |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | Cl.Clc1ccccc1COc1ccc(CNCCCSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24ClN5OS.ClH/c25-23-10-5-4-7-20(23)18-31-22-13-11-19(12-14-22)17-26-15-6-16-32-24-27-28-29-30(24)21-8-2-1-3-9-21;/h1-5,7-14,26H,6,15-18H2;1H |
| InChIKey | KEUIEUBWRIUFJC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|