C23H20BrCl2N5OS — CID 4724734
N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 4724734) has the molecular formula C23H20BrCl2N5OS and a molecular weight of 565.32 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 4724734 |
| Molecular Formula | C23H20BrCl2N5OS |
| Molecular Weight | 565.32 g/mol |
| Exact Mass | 562.99 |
| IUPAC Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Clc1ccc(COc2ccc(Br)cc2CNCCSc2nnnn2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C23H20BrCl2N5OS/c24-18-7-9-22(32-15-16-6-8-19(25)13-21(16)26)17(12-18)14-27-10-11-33-23-28-29-30-31(23)20-4-2-1-3-5-20/h1-9,12-13,27H,10-11,14-15H2 |
| InChIKey | XVSAYMCOWFAQJH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.32 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|