C18H19Cl2N5OS — CID 4718131
N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 4718131) has the molecular formula C18H19Cl2N5OS and a molecular weight of 424.36 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 4718131 |
| Molecular Formula | C18H19Cl2N5OS |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Cn1nnnc1SCCNCc1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N5OS/c1-25-18(22-23-24-25)27-9-8-21-11-13-4-2-3-5-17(13)26-12-14-6-7-15(19)10-16(14)20/h2-7,10,21H,8-9,11-12H2,1H3 |
| InChIKey | BDFRDBNXBSMFGF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|