C19H21Cl2N5OS — CID 4725189
N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 4725189) has the molecular formula C19H21Cl2N5OS and a molecular weight of 438.38 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 4725189 |
| Molecular Formula | C19H21Cl2N5OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Cn1nnnc1SCCCNCc1cc(Cl)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H21Cl2N5OS/c1-26-19(23-24-25-26)28-10-4-9-22-12-15-11-16(20)7-8-18(15)27-13-14-5-2-3-6-17(14)21/h2-3,5-8,11,22H,4,9-10,12-13H2,1H3 |
| InChIKey | QAJYYTHAACUPFT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|