C27H26Cl2N6S — CID 17158659
N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17158659) has the molecular formula C27H26Cl2N6S and a molecular weight of 537.52 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17158659 |
| Molecular Formula | C27H26Cl2N6S |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Cc1c(CNCCCSc2nnnn2-c2ccccc2)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H26Cl2N6S/c1-19-24(17-30-14-7-15-36-27-31-32-33-35(27)22-8-3-2-4-9-22)23-10-5-6-11-26(23)34(19)18-20-12-13-21(28)16-25(20)29/h2-6,8-13,16,30H,7,14-15,17-18H2,1H3 |
| InChIKey | ULONPTVTKUPTQH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|